C22H17Br2ClN2O3 — CID 126273340
(2S)-N-[(Z)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2-phenylacetamide (PubChem CID 126273340) has the molecular formula C22H17Br2ClN2O3 and a molecular weight of 552.65 g/mol. Its IUPAC name is (2S)-N-[(Z)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2S)-N-[(Z)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 126273340 |
| Molecular Formula | C22H17Br2ClN2O3 |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 549.93 |
| IUPAC Name | (2S)-N-[(Z)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2-phenylacetamide |
| SMILES | O=C(N/N=C\c1cc(Br)c(OCc2ccccc2Cl)c(Br)c1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H17Br2ClN2O3/c23-17-10-14(12-26-27-22(29)20(28)15-6-2-1-3-7-15)11-18(24)21(17)30-13-16-8-4-5-9-19(16)25/h1-12,20,28H,13H2,(H,27,29)/b26-12-/t20-/m0/s1 |
| InChIKey | TUBBHECMXVUDDE-ZEJFDVOKSA-N |
| XLogP | 5.63 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|