C24H22BrClN2O4 — CID 126152996
(2R)-N-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-hydroxy-2-phenylacetamide (PubChem CID 126152996) has the molecular formula C24H22BrClN2O4 and a molecular weight of 517.81 g/mol. Its IUPAC name is (2R)-N-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2R)-N-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 126152996 |
| Molecular Formula | C24H22BrClN2O4 |
| Molecular Weight | 517.81 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | (2R)-N-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-hydroxy-2-phenylacetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](O)c2ccccc2)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22BrClN2O4/c1-2-31-21-13-17(14-27-28-24(30)22(29)18-6-4-3-5-7-18)12-20(25)23(21)32-15-16-8-10-19(26)11-9-16/h3-14,22,29H,2,15H2,1H3,(H,28,30)/b27-14-/t22-/m1/s1 |
| InChIKey | SRTGCUAUGXZLNC-IPYFEQEDSA-N |
| XLogP | 5.26 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.81 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|