C17H17BrClN3O3 — CID 6872613
[(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]urea (PubChem CID 6872613) has the molecular formula C17H17BrClN3O3 and a molecular weight of 426.70 g/mol. Its IUPAC name is [(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]urea.
| Compound Name | [(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 6872613 |
| Molecular Formula | C17H17BrClN3O3 |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | [(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]urea |
| SMILES | CCOc1cc(/C=N/NC(N)=O)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17BrClN3O3/c1-2-24-15-8-12(9-21-22-17(20)23)7-14(18)16(15)25-10-11-3-5-13(19)6-4-11/h3-9H,2,10H2,1H3,(H3,20,22,23)/b21-9+ |
| InChIKey | ZYYJFFYWESZPQM-ZVBGSRNCSA-N |
| XLogP | 4.08 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|