C30H26Br2N2O3 — CID 126396799
N-[(E)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2,2-diphenylacetamide (PubChem CID 126396799) has the molecular formula C30H26Br2N2O3 and a molecular weight of 622.36 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(E)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 126396799 |
| Molecular Formula | C30H26Br2N2O3 |
| Molecular Weight | 622.36 g/mol |
| Exact Mass | 620.03 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2,2-diphenylacetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(c2ccccc2)c2ccccc2)cc(Br)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C30H26Br2N2O3/c1-2-36-27-18-22(17-26(32)29(27)37-20-21-13-15-25(31)16-14-21)19-33-34-30(35)28(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-19,28H,2,20H2,1H3,(H,34,35)/b33-19+ |
| InChIKey | OLIJANHQHKHPRM-HNSNBQBZSA-N |
| XLogP | 7.47 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.36 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|