C22H18Br2N2O — CID 126396553
N-[(E)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2,2-diphenylacetamide (PubChem CID 126396553) has the molecular formula C22H18Br2N2O and a molecular weight of 486.21 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(E)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 126396553 |
| Molecular Formula | C22H18Br2N2O |
| Molecular Weight | 486.21 g/mol |
| Exact Mass | 483.98 |
| IUPAC Name | N-[(E)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2,2-diphenylacetamide |
| SMILES | Cc1c(Br)cc(/C=N/NC(=O)C(c2ccccc2)c2ccccc2)cc1Br |
| InChI | InChI=1S/C22H18Br2N2O/c1-15-19(23)12-16(13-20(15)24)14-25-26-22(27)21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-14,21H,1H3,(H,26,27)/b25-14+ |
| InChIKey | MUJFJUOXMJZMGF-AFUMVMLFSA-N |
| XLogP | 5.80 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.21 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|