C19H15BrN2OS — CID 5432164
N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2,2-diphenylacetamide (PubChem CID 5432164) has the molecular formula C19H15BrN2OS and a molecular weight of 399.31 g/mol. Its IUPAC name is N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 5432164 |
| Molecular Formula | C19H15BrN2OS |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2,2-diphenylacetamide |
| SMILES | O=C(N/N=C\c1ccc(Br)s1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H15BrN2OS/c20-17-12-11-16(24-17)13-21-22-19(23)18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,18H,(H,22,23)/b21-13- |
| InChIKey | JWRALBLYSOYQNN-BKUYFWCQSA-N |
| XLogP | 4.79 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|