C10H13BrN2O2S — CID 6391739
tert-butyl N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]carbamate (PubChem CID 6391739) has the molecular formula C10H13BrN2O2S and a molecular weight of 305.20 g/mol. Its IUPAC name is tert-butyl N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 6391739 |
| Molecular Formula | C10H13BrN2O2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | tert-butyl N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=C\c1ccc(Br)s1 |
| InChI | InChI=1S/C10H13BrN2O2S/c1-10(2,3)15-9(14)13-12-6-7-4-5-8(11)16-7/h4-6H,1-3H3,(H,13,14)/b12-6- |
| InChIKey | YRUQQMGMOWBTEA-SDQBBNPISA-N |
| XLogP | 3.37 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|