C7H7ClN2O2S — CID 3254663
methyl N-[(5-chlorothiophen-2-yl)methylideneamino]carbamate (PubChem CID 3254663) has the molecular formula C7H7ClN2O2S and a molecular weight of 218.67 g/mol. Its IUPAC name is methyl N-[(5-chlorothiophen-2-yl)methylideneamino]carbamate.
| Compound Name | methyl N-[(5-chlorothiophen-2-yl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 3254663 |
| Molecular Formula | C7H7ClN2O2S |
| Molecular Weight | 218.67 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | methyl N-[(5-chlorothiophen-2-yl)methylideneamino]carbamate |
| SMILES | COC(=O)NN=Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C7H7ClN2O2S/c1-12-7(11)10-9-4-5-2-3-6(8)13-5/h2-4H,1H3,(H,10,11) |
| InChIKey | YAWGLZHYAAFKRV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.67 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|