C15H10Cl2N2OS2 — CID 3660779
3-chloro-N-[(5-chlorothiophen-2-yl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide (PubChem CID 3660779) has the molecular formula C15H10Cl2N2OS2 and a molecular weight of 369.30 g/mol. Its IUPAC name is 3-chloro-N-[(5-chlorothiophen-2-yl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(5-chlorothiophen-2-yl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3660779 |
| Molecular Formula | C15H10Cl2N2OS2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 3-chloro-N-[(5-chlorothiophen-2-yl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2c(Cl)c(C(=O)NN=Cc3ccc(Cl)s3)sc2c1 |
| InChI | InChI=1S/C15H10Cl2N2OS2/c1-8-2-4-10-11(6-8)22-14(13(10)17)15(20)19-18-7-9-3-5-12(16)21-9/h2-7H,1H3,(H,19,20) |
| InChIKey | NBTILTNBDATIEN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|