C18H14BrClN2O3S — CID 135684598
N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide (PubChem CID 135684598) has the molecular formula C18H14BrClN2O3S and a molecular weight of 453.75 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135684598 |
| Molecular Formula | C18H14BrClN2O3S |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 451.96 |
| IUPAC Name | N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2sc3cc(C)ccc3c2Cl)cc(Br)c1O |
| InChI | InChI=1S/C18H14BrClN2O3S/c1-9-3-4-11-14(5-9)26-17(15(11)20)18(24)22-21-8-10-6-12(19)16(23)13(7-10)25-2/h3-8,23H,1-2H3,(H,22,24)/b21-8+ |
| InChIKey | YGEFGFMGRCXXFH-ODCIPOBUSA-N |
| XLogP | 5.10 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|