C21H21ClN2O3S — CID 6080009
3-chloro-N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide (PubChem CID 6080009) has the molecular formula C21H21ClN2O3S and a molecular weight of 416.93 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 6080009 |
| Molecular Formula | C21H21ClN2O3S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 3-chloro-N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide |
| SMILES | CCCOc1ccc(/C=N\NC(=O)c2sc3cc(C)ccc3c2Cl)cc1OC |
| InChI | InChI=1S/C21H21ClN2O3S/c1-4-9-27-16-8-6-14(11-17(16)26-3)12-23-24-21(25)20-19(22)15-7-5-13(2)10-18(15)28-20/h5-8,10-12H,4,9H2,1-3H3,(H,24,25)/b23-12- |
| InChIKey | ASCVYFPMMCHRIO-FMCGGJTJSA-N |
| XLogP | 5.42 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|