C17H17ClN2OS — CID 40601361
3-chloro-N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide (PubChem CID 40601361) has the molecular formula C17H17ClN2OS and a molecular weight of 332.86 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 40601361 |
| Molecular Formula | C17H17ClN2OS |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-chloro-N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-6-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2c(Cl)c(C(=O)N/N=C\[C@@H]3CC=CCC3)sc2c1 |
| InChI | InChI=1S/C17H17ClN2OS/c1-11-7-8-13-14(9-11)22-16(15(13)18)17(21)20-19-10-12-5-3-2-4-6-12/h2-3,7-10,12H,4-6H2,1H3,(H,20,21)/b19-10-/t12-/m1/s1 |
| InChIKey | MWZBFONMTADEDL-FGHSJCFPSA-N |
| XLogP | 4.94 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|