C16H16Br2N4O2S2 — CID 5114030
N,N'-bis[(5-bromothiophen-2-yl)methylideneamino]hexanediamide (PubChem CID 5114030) has the molecular formula C16H16Br2N4O2S2 and a molecular weight of 520.27 g/mol. Its IUPAC name is N,N'-bis[(5-bromothiophen-2-yl)methylideneamino]hexanediamide.
| Compound Name | N,N'-bis[(5-bromothiophen-2-yl)methylideneamino]hexanediamide |
|---|---|
| PubChem CID | 5114030 |
| Molecular Formula | C16H16Br2N4O2S2 |
| Molecular Weight | 520.27 g/mol |
| Exact Mass | 517.91 |
| IUPAC Name | N,N'-bis[(5-bromothiophen-2-yl)methylideneamino]hexanediamide |
| SMILES | O=C(CCCCC(=O)NN=Cc1ccc(Br)s1)NN=Cc1ccc(Br)s1 |
| InChI | InChI=1S/C16H16Br2N4O2S2/c17-13-7-5-11(25-13)9-19-21-15(23)3-1-2-4-16(24)22-20-10-12-6-8-14(18)26-12/h5-10H,1-4H2,(H,21,23)(H,22,24) |
| InChIKey | XPUJPXIPYGOGCR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|