C8H6BrN3OS — CID 5375065
N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2-cyanoacetamide (PubChem CID 5375065) has the molecular formula C8H6BrN3OS and a molecular weight of 272.13 g/mol. Its IUPAC name is N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2-cyanoacetamide.
| Compound Name | N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2-cyanoacetamide |
|---|---|
| PubChem CID | 5375065 |
| Molecular Formula | C8H6BrN3OS |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 270.94 |
| IUPAC Name | N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]-2-cyanoacetamide |
| SMILES | N#CCC(=O)N/N=C\c1ccc(Br)s1 |
| InChI | InChI=1S/C8H6BrN3OS/c9-7-2-1-6(14-7)5-11-12-8(13)3-4-10/h1-2,5H,3H2,(H,12,13)/b11-5- |
| InChIKey | CNLPOKJCNDSJFT-WZUFQYTHSA-N |
| XLogP | 1.87 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|