C14H10BrClN4O2S — CID 4511358
N-[[3-[(4-bromophenyl)methyl]-4-chloro-2-oxo-1,3-thiazol-5-yl]methylideneamino]-2-cyanoacetamide (PubChem CID 4511358) has the molecular formula C14H10BrClN4O2S and a molecular weight of 413.68 g/mol. Its IUPAC name is N-[[3-[(4-bromophenyl)methyl]-4-chloro-2-oxo-1,3-thiazol-5-yl]methylideneamino]-2-cyanoacetamide.
| Compound Name | N-[[3-[(4-bromophenyl)methyl]-4-chloro-2-oxo-1,3-thiazol-5-yl]methylideneamino]-2-cyanoacetamide |
|---|---|
| PubChem CID | 4511358 |
| Molecular Formula | C14H10BrClN4O2S |
| Molecular Weight | 413.68 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | N-[[3-[(4-bromophenyl)methyl]-4-chloro-2-oxo-1,3-thiazol-5-yl]methylideneamino]-2-cyanoacetamide |
| SMILES | N#CCC(=O)NN=Cc1sc(=O)n(Cc2ccc(Br)cc2)c1Cl |
| InChI | InChI=1S/C14H10BrClN4O2S/c15-10-3-1-9(2-4-10)8-20-13(16)11(23-14(20)22)7-18-19-12(21)5-6-17/h1-4,7H,5,8H2,(H,19,21) |
| InChIKey | AMHIPOAFGJYDHG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|