C19H14ClN3O5S — CID 6879448
3-[[4-chloro-5-[(E)-[(3-hydroxybenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoic acid (PubChem CID 6879448) has the molecular formula C19H14ClN3O5S and a molecular weight of 431.86 g/mol. Its IUPAC name is 3-[[4-chloro-5-[(E)-[(3-hydroxybenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-chloro-5-[(E)-[(3-hydroxybenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 6879448 |
| Molecular Formula | C19H14ClN3O5S |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 3-[[4-chloro-5-[(E)-[(3-hydroxybenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(Cn2c(Cl)c(/C=N/NC(=O)c3cccc(O)c3)sc2=O)c1 |
| InChI | InChI=1S/C19H14ClN3O5S/c20-16-15(9-21-22-17(25)12-4-2-6-14(24)8-12)29-19(28)23(16)10-11-3-1-5-13(7-11)18(26)27/h1-9,24H,10H2,(H,22,25)(H,26,27)/b21-9+ |
| InChIKey | UTDIUCBMMDBSPR-ZVBGSRNCSA-N |
| XLogP | 2.78 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|