C18H15ClN4O3S — CID 135795602
N-[(E)-[4-chloro-2-(2-methoxyanilino)-1,3-thiazol-5-yl]methylideneamino]-3-hydroxybenzamide (PubChem CID 135795602) has the molecular formula C18H15ClN4O3S and a molecular weight of 402.86 g/mol. Its IUPAC name is N-[(E)-[4-chloro-2-(2-methoxyanilino)-1,3-thiazol-5-yl]methylideneamino]-3-hydroxybenzamide.
| Compound Name | N-[(E)-[4-chloro-2-(2-methoxyanilino)-1,3-thiazol-5-yl]methylideneamino]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 135795602 |
| Molecular Formula | C18H15ClN4O3S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N-[(E)-[4-chloro-2-(2-methoxyanilino)-1,3-thiazol-5-yl]methylideneamino]-3-hydroxybenzamide |
| SMILES | COc1ccccc1Nc1nc(Cl)c(/C=N/NC(=O)c2cccc(O)c2)s1 |
| InChI | InChI=1S/C18H15ClN4O3S/c1-26-14-8-3-2-7-13(14)21-18-22-16(19)15(27-18)10-20-23-17(25)11-5-4-6-12(24)9-11/h2-10,24H,1H3,(H,21,22)(H,23,25)/b20-10+ |
| InChIKey | XDLVECDUPXFUJD-KEBDBYFISA-N |
| XLogP | 4.02 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|