C16H19ClN4O3S — CID 135795523
tert-butyl N-[(E)-[4-chloro-2-(2-methoxyanilino)-1,3-thiazol-5-yl]methylideneamino]carbamate (PubChem CID 135795523) has the molecular formula C16H19ClN4O3S and a molecular weight of 382.87 g/mol. Its IUPAC name is tert-butyl N-[(E)-[4-chloro-2-(2-methoxyanilino)-1,3-thiazol-5-yl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-[4-chloro-2-(2-methoxyanilino)-1,3-thiazol-5-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 135795523 |
| Molecular Formula | C16H19ClN4O3S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | tert-butyl N-[(E)-[4-chloro-2-(2-methoxyanilino)-1,3-thiazol-5-yl]methylideneamino]carbamate |
| SMILES | COc1ccccc1Nc1nc(Cl)c(/C=N/NC(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C16H19ClN4O3S/c1-16(2,3)24-15(22)21-18-9-12-13(17)20-14(25-12)19-10-7-5-6-8-11(10)23-4/h5-9H,1-4H3,(H,19,20)(H,21,22)/b18-9+ |
| InChIKey | FKKAEZJFASUEIU-GIJQJNRQSA-N |
| XLogP | 4.41 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|