C19H14ClN5O2S — CID 135763398
N-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-2-(2-cyanophenoxy)acetamide (PubChem CID 135763398) has the molecular formula C19H14ClN5O2S and a molecular weight of 411.87 g/mol. Its IUPAC name is N-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-2-(2-cyanophenoxy)acetamide.
| Compound Name | N-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-2-(2-cyanophenoxy)acetamide |
|---|---|
| PubChem CID | 135763398 |
| Molecular Formula | C19H14ClN5O2S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-2-(2-cyanophenoxy)acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)N/N=C/c1sc(Nc2ccccc2)nc1Cl |
| InChI | InChI=1S/C19H14ClN5O2S/c20-18-16(28-19(24-18)23-14-7-2-1-3-8-14)11-22-25-17(26)12-27-15-9-5-4-6-13(15)10-21/h1-9,11H,12H2,(H,23,24)(H,25,26)/b22-11+ |
| InChIKey | OGLKPVQDLFBYJB-SSDVNMTOSA-N |
| XLogP | 3.94 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|