C16H20ClN5OS2 — CID 135817730
1-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-3-(3-ethoxypropyl)thiourea (PubChem CID 135817730) has the molecular formula C16H20ClN5OS2 and a molecular weight of 397.96 g/mol. Its IUPAC name is 1-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 135817730 |
| Molecular Formula | C16H20ClN5OS2 |
| Molecular Weight | 397.96 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 1-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)N/N=C/c1sc(Nc2ccccc2)nc1Cl |
| InChI | InChI=1S/C16H20ClN5OS2/c1-2-23-10-6-9-18-15(24)22-19-11-13-14(17)21-16(25-13)20-12-7-4-3-5-8-12/h3-5,7-8,11H,2,6,9-10H2,1H3,(H,20,21)(H2,18,22,24)/b19-11+ |
| InChIKey | RODXGCUZEDGPHY-YBFXNURJSA-N |
| XLogP | 3.76 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.96 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|