C16H9ClF4N4S — CID 135576309
4-chloro-N-phenyl-5-[(E)-[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-amine (PubChem CID 135576309) has the molecular formula C16H9ClF4N4S and a molecular weight of 400.79 g/mol. Its IUPAC name is 4-chloro-N-phenyl-5-[(E)-[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-N-phenyl-5-[(E)-[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135576309 |
| Molecular Formula | C16H9ClF4N4S |
| Molecular Weight | 400.79 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 4-chloro-N-phenyl-5-[(E)-[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-amine |
| SMILES | Fc1cc(F)c(F)c(N/N=C/c2sc(Nc3ccccc3)nc2Cl)c1F |
| InChI | InChI=1S/C16H9ClF4N4S/c17-15-11(26-16(24-15)23-8-4-2-1-3-5-8)7-22-25-14-12(20)9(18)6-10(19)13(14)21/h1-7,25H,(H,23,24)/b22-7+ |
| InChIKey | IXXNCEUSERJENT-QPJQQBGISA-N |
| XLogP | 5.54 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.79 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|