C14H16ClN5S2 — CID 135612521
1-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-3-propan-2-ylthiourea (PubChem CID 135612521) has the molecular formula C14H16ClN5S2 and a molecular weight of 353.90 g/mol. Its IUPAC name is 1-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-3-propan-2-ylthiourea.
| Compound Name | 1-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 135612521 |
| Molecular Formula | C14H16ClN5S2 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 1-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)N/N=C/c1sc(Nc2ccccc2)nc1Cl |
| InChI | InChI=1S/C14H16ClN5S2/c1-9(2)17-13(21)20-16-8-11-12(15)19-14(22-11)18-10-6-4-3-5-7-10/h3-9H,1-2H3,(H,18,19)(H2,17,20,21)/b16-8+ |
| InChIKey | UJSMDEHNVRBDNP-LZYBPNLTSA-N |
| XLogP | 3.75 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|