C15H15Cl2N5O2S — CID 135575856
N'-[(E)-[4-chloro-2-(2-chloroanilino)-1,3-thiazol-5-yl]methylideneamino]-N-propan-2-yloxamide (PubChem CID 135575856) has the molecular formula C15H15Cl2N5O2S and a molecular weight of 400.29 g/mol. Its IUPAC name is N'-[(E)-[4-chloro-2-(2-chloroanilino)-1,3-thiazol-5-yl]methylideneamino]-N-propan-2-yloxamide.
| Compound Name | N'-[(E)-[4-chloro-2-(2-chloroanilino)-1,3-thiazol-5-yl]methylideneamino]-N-propan-2-yloxamide |
|---|---|
| PubChem CID | 135575856 |
| Molecular Formula | C15H15Cl2N5O2S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | N'-[(E)-[4-chloro-2-(2-chloroanilino)-1,3-thiazol-5-yl]methylideneamino]-N-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)N/N=C/c1sc(Nc2ccccc2Cl)nc1Cl |
| InChI | InChI=1S/C15H15Cl2N5O2S/c1-8(2)19-13(23)14(24)22-18-7-11-12(17)21-15(25-11)20-10-6-4-3-5-9(10)16/h3-8H,1-2H3,(H,19,23)(H,20,21)(H,22,24)/b18-7+ |
| InChIKey | XFHRGKFFWXLPBR-CNHKJKLMSA-N |
| XLogP | 3.17 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|