C17H17ClN6S — CID 135795487
4-chloro-5-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]-N-(2-methylphenyl)-1,3-thiazol-2-amine (PubChem CID 135795487) has the molecular formula C17H17ClN6S and a molecular weight of 372.89 g/mol. Its IUPAC name is 4-chloro-5-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]-N-(2-methylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-5-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]-N-(2-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135795487 |
| Molecular Formula | C17H17ClN6S |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 4-chloro-5-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]-N-(2-methylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1cc(C)nc(N/N=C/c2sc(Nc3ccccc3C)nc2Cl)n1 |
| InChI | InChI=1S/C17H17ClN6S/c1-10-6-4-5-7-13(10)22-17-23-15(18)14(25-17)9-19-24-16-20-11(2)8-12(3)21-16/h4-9H,1-3H3,(H,22,23)(H,20,21,24)/b19-9+ |
| InChIKey | QOZSAEKGXQRCFX-DJKKODMXSA-N |
| XLogP | 4.70 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|