C21H17ClN4 — CID 4077407
N-[(10-chloroanthracen-9-yl)methylideneamino]-4,6-dimethylpyrimidin-2-amine (PubChem CID 4077407) has the molecular formula C21H17ClN4 and a molecular weight of 360.85 g/mol. Its IUPAC name is N-[(10-chloroanthracen-9-yl)methylideneamino]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-[(10-chloroanthracen-9-yl)methylideneamino]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 4077407 |
| Molecular Formula | C21H17ClN4 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[(10-chloroanthracen-9-yl)methylideneamino]-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NN=Cc2c3ccccc3c(Cl)c3ccccc23)n1 |
| InChI | InChI=1S/C21H17ClN4/c1-13-11-14(2)25-21(24-13)26-23-12-19-15-7-3-5-9-17(15)20(22)18-10-6-4-8-16(18)19/h3-12H,1-2H3,(H,24,25,26) |
| InChIKey | GXUSCERMBYARLK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|