C12H15N5 — CID 42994964
4,6-dimethyl-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]pyrimidin-2-amine (PubChem CID 42994964) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 4,6-dimethyl-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 42994964 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 4,6-dimethyl-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]pyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(N/N=C/c2cccn2C)n1 |
| InChI | InChI=1S/C12H15N5/c1-9-7-10(2)15-12(14-9)16-13-8-11-5-4-6-17(11)3/h4-8H,1-3H3,(H,14,15,16)/b13-8+ |
| InChIKey | BXYDMKKBDXUQNT-MDWZMJQESA-N |
| XLogP | 1.88 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|