C17H18N4 — CID 3111132
3,7-dimethyl-N-[(1-methylpyrrol-2-yl)methylideneamino]quinolin-2-amine (PubChem CID 3111132) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 3,7-dimethyl-N-[(1-methylpyrrol-2-yl)methylideneamino]quinolin-2-amine.
| Compound Name | 3,7-dimethyl-N-[(1-methylpyrrol-2-yl)methylideneamino]quinolin-2-amine |
|---|---|
| PubChem CID | 3111132 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3,7-dimethyl-N-[(1-methylpyrrol-2-yl)methylideneamino]quinolin-2-amine |
| SMILES | Cc1ccc2cc(C)c(NN=Cc3cccn3C)nc2c1 |
| InChI | InChI=1S/C17H18N4/c1-12-6-7-14-10-13(2)17(19-16(14)9-12)20-18-11-15-5-4-8-21(15)3/h4-11H,1-3H3,(H,19,20) |
| InChIKey | OSYKPVSSUDUPSE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|