C7H9N3O2 — CID 23220001
[(E)-(1-methylpyrrol-2-yl)methylideneamino]carbamic acid (PubChem CID 23220001) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is [(E)-(1-methylpyrrol-2-yl)methylideneamino]carbamic acid.
| Compound Name | [(E)-(1-methylpyrrol-2-yl)methylideneamino]carbamic acid |
|---|---|
| PubChem CID | 23220001 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | [(E)-(1-methylpyrrol-2-yl)methylideneamino]carbamic acid |
| SMILES | Cn1cccc1/C=N/NC(=O)O |
| InChI | InChI=1S/C7H9N3O2/c1-10-4-2-3-6(10)5-8-9-7(11)12/h2-5,9H,1H3,(H,11,12)/b8-5+ |
| InChIKey | KMDKOAAFWQACGG-VMPITWQZSA-N |
| XLogP | 0.63 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|