C9H13N3O — CID 45123007
N-[(Z)-(1-methylpyrrol-2-yl)methylideneamino]propanamide (PubChem CID 45123007) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is N-[(Z)-(1-methylpyrrol-2-yl)methylideneamino]propanamide.
| Compound Name | N-[(Z)-(1-methylpyrrol-2-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 45123007 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-[(Z)-(1-methylpyrrol-2-yl)methylideneamino]propanamide |
| SMILES | CCC(=O)N/N=C\c1cccn1C |
| InChI | InChI=1S/C9H13N3O/c1-3-9(13)11-10-7-8-5-4-6-12(8)2/h4-7H,3H2,1-2H3,(H,11,13)/b10-7- |
| InChIKey | WMXWLYZFNRTHMN-YFHOEESVSA-N |
| XLogP | 0.89 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|