C14H14N6O — CID 6897555
2-(benzotriazol-1-yl)-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]acetamide (PubChem CID 6897555) has the molecular formula C14H14N6O and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6897555 |
| Molecular Formula | C14H14N6O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]acetamide |
| SMILES | Cn1cccc1/C=N/NC(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C14H14N6O/c1-19-8-4-5-11(19)9-15-17-14(21)10-20-13-7-3-2-6-12(13)16-18-20/h2-9H,10H2,1H3,(H,17,21)/b15-9+ |
| InChIKey | GDNZQKFPNHKEGJ-OQLLNIDSSA-N |
| XLogP | 0.92 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|