C18H19N5O4 — CID 1110815
2-(benzotriazol-1-yl)-N-[(2,4,5-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 1110815) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[(2,4,5-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[(2,4,5-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1110815 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[(2,4,5-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(OC)c(OC)cc1C=NNC(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C18H19N5O4/c1-25-15-9-17(27-3)16(26-2)8-12(15)10-19-21-18(24)11-23-14-7-5-4-6-13(14)20-22-23/h4-10H,11H2,1-3H3,(H,21,24) |
| InChIKey | QRXNLRCRHQRXKE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|