C23H19ClFN5O3 — CID 4647271
2-(benzotriazol-1-yl)-N-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide (PubChem CID 4647271) has the molecular formula C23H19ClFN5O3 and a molecular weight of 467.89 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4647271 |
| Molecular Formula | C23H19ClFN5O3 |
| Molecular Weight | 467.89 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(C=NNC(=O)Cn2nnc3ccccc32)ccc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C23H19ClFN5O3/c1-32-22-11-15(9-10-21(22)33-14-16-17(24)5-4-6-18(16)25)12-26-28-23(31)13-30-20-8-3-2-7-19(20)27-29-30/h2-12H,13-14H2,1H3,(H,28,31) |
| InChIKey | QJKSHUDCTPUUDL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.89 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|