C24H20Cl2N4O3S — CID 46300424
2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide (PubChem CID 46300424) has the molecular formula C24H20Cl2N4O3S and a molecular weight of 515.42 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 46300424 |
| Molecular Formula | C24H20Cl2N4O3S |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CSc2nc3ccccc3[nH]2)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H20Cl2N4O3S/c1-32-22-11-15(9-10-21(22)33-13-16-17(25)5-4-6-18(16)26)12-27-30-23(31)14-34-24-28-19-7-2-3-8-20(19)29-24/h2-12H,13-14H2,1H3,(H,28,29)(H,30,31)/b27-12- |
| InChIKey | KSDKUHGQIQBDNX-PPDIBHTLSA-N |
| XLogP | 5.70 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|