C24H19Cl3N4O3S — CID 46300595
2-(1H-benzimidazol-2-ylsulfanyl)-N-[(E)-[3-methoxy-2-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 46300595) has the molecular formula C24H19Cl3N4O3S and a molecular weight of 549.87 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(E)-[3-methoxy-2-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(E)-[3-methoxy-2-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 46300595 |
| Molecular Formula | C24H19Cl3N4O3S |
| Molecular Weight | 549.87 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(E)-[3-methoxy-2-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | COc1cccc(/C=N/NC(=O)CSc2nc3ccccc3[nH]2)c1OCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C24H19Cl3N4O3S/c1-33-20-8-4-5-14(23(20)34-12-15-16(25)9-10-17(26)22(15)27)11-28-31-21(32)13-35-24-29-18-6-2-3-7-19(18)30-24/h2-11H,12-13H2,1H3,(H,29,30)(H,31,32)/b28-11+ |
| InChIKey | NZUUQABNJGWCJK-IPBVOBEMSA-N |
| XLogP | 6.35 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.87 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|