C23H17Cl3N4O2S — CID 46300550
2-(1H-benzimidazol-2-ylsulfanyl)-N-[(E)-[2-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 46300550) has the molecular formula C23H17Cl3N4O2S and a molecular weight of 519.84 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(E)-[2-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(E)-[2-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 46300550 |
| Molecular Formula | C23H17Cl3N4O2S |
| Molecular Weight | 519.84 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(E)-[2-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)N/N=C/c1ccccc1OCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C23H17Cl3N4O2S/c24-16-9-10-17(25)22(26)15(16)12-32-20-8-4-1-5-14(20)11-27-30-21(31)13-33-23-28-18-6-2-3-7-19(18)29-23/h1-11H,12-13H2,(H,28,29)(H,30,31)/b27-11+ |
| InChIKey | JKSCRWFSTLBTOP-LUOAPIJWSA-N |
| XLogP | 6.34 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.84 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|