C22H26N4O3S — CID 39756935
2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(4-butoxy-3-ethoxyphenyl)methylideneamino]acetamide (PubChem CID 39756935) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(4-butoxy-3-ethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(4-butoxy-3-ethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 39756935 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(4-butoxy-3-ethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCOc1ccc(/C=N\NC(=O)CSc2nc3ccccc3[nH]2)cc1OCC |
| InChI | InChI=1S/C22H26N4O3S/c1-3-5-12-29-19-11-10-16(13-20(19)28-4-2)14-23-26-21(27)15-30-22-24-17-8-6-7-9-18(17)25-22/h6-11,13-14H,3-5,12,15H2,1-2H3,(H,24,25)(H,26,27)/b23-14- |
| InChIKey | STNXDDAGCYZQPN-UCQKPKSFSA-N |
| XLogP | 4.38 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|