C20H21N5O5S — CID 110509326
2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]acetamide (PubChem CID 110509326) has the molecular formula C20H21N5O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 110509326 |
| Molecular Formula | C20H21N5O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCOc1c(OC)cc(/C=N\NC(=O)CSc2nc3ccccc3[nH]2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21N5O5S/c1-3-8-30-19-16(25(27)28)9-13(10-17(19)29-2)11-21-24-18(26)12-31-20-22-14-6-4-5-7-15(14)23-20/h4-7,9-11H,3,8,12H2,1-2H3,(H,22,23)(H,24,26)/b21-11- |
| InChIKey | CYZUFLMYVCKYJX-NHDPSOOVSA-N |
| XLogP | 3.51 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|