C18H17N5O5S — CID 110509329
2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 110509329) has the molecular formula C18H17N5O5S and a molecular weight of 415.43 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 110509329 |
| Molecular Formula | C18H17N5O5S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[(Z)-(3,4-dimethoxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CSc2nc3ccccc3[nH]2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C18H17N5O5S/c1-27-15-8-11(7-14(23(25)26)17(15)28-2)9-19-22-16(24)10-29-18-20-12-5-3-4-6-13(12)21-18/h3-9H,10H2,1-2H3,(H,20,21)(H,22,24)/b19-9- |
| InChIKey | HCGAUKQYFWLUGG-OCKHKDLRSA-N |
| XLogP | 2.73 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|