C24H21Cl2N5O3 — CID 5172148
2-(benzotriazol-1-yl)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]propanamide (PubChem CID 5172148) has the molecular formula C24H21Cl2N5O3 and a molecular weight of 498.37 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]propanamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 5172148 |
| Molecular Formula | C24H21Cl2N5O3 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]propanamide |
| SMILES | COc1cc(C=NNC(=O)C(C)n2nnc3ccccc32)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H21Cl2N5O3/c1-15(31-21-6-4-3-5-20(21)28-30-31)24(32)29-27-13-16-8-10-22(23(12-16)33-2)34-14-17-7-9-18(25)19(26)11-17/h3-13,15H,14H2,1-2H3,(H,29,32) |
| InChIKey | JGQYYXSVOYYJNC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|