C23H19Cl3N2O3 — CID 126058298
2-chloro-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylbenzamide (PubChem CID 126058298) has the molecular formula C23H19Cl3N2O3 and a molecular weight of 477.78 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 126058298 |
| Molecular Formula | C23H19Cl3N2O3 |
| Molecular Weight | 477.78 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 2-chloro-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylbenzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(C)cc2Cl)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H19Cl3N2O3/c1-14-3-6-17(19(25)9-14)23(29)28-27-12-15-5-8-21(22(11-15)30-2)31-13-16-4-7-18(24)20(26)10-16/h3-12H,13H2,1-2H3,(H,28,29)/b27-12- |
| InChIKey | OARLGPYUWOGENV-PPDIBHTLSA-N |
| XLogP | 6.31 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.78 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|