C22H18Cl2N2O4 — CID 110841250
2-[2-[[3-[(3,4-dichlorophenyl)methoxy]-4-methoxyphenyl]methylidene]hydrazinyl]benzoic acid (PubChem CID 110841250) has the molecular formula C22H18Cl2N2O4 and a molecular weight of 445.30 g/mol. Its IUPAC name is 2-[2-[[3-[(3,4-dichlorophenyl)methoxy]-4-methoxyphenyl]methylidene]hydrazinyl]benzoic acid.
| Compound Name | 2-[2-[[3-[(3,4-dichlorophenyl)methoxy]-4-methoxyphenyl]methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 110841250 |
| Molecular Formula | C22H18Cl2N2O4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-[2-[[3-[(3,4-dichlorophenyl)methoxy]-4-methoxyphenyl]methylidene]hydrazinyl]benzoic acid |
| SMILES | COc1ccc(C=NNc2ccccc2C(=O)O)cc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N2O4/c1-29-20-9-7-14(12-25-26-19-5-3-2-4-16(19)22(27)28)11-21(20)30-13-15-6-8-17(23)18(24)10-15/h2-12,26H,13H2,1H3,(H,27,28) |
| InChIKey | AOWZLOUPZOPEJG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|