C22H19FN2O4 — CID 19578665
2-[(2E)-2-[[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylidene]hydrazinyl]benzoic acid (PubChem CID 19578665) has the molecular formula C22H19FN2O4 and a molecular weight of 394.40 g/mol. Its IUPAC name is 2-[(2E)-2-[[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylidene]hydrazinyl]benzoic acid.
| Compound Name | 2-[(2E)-2-[[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 19578665 |
| Molecular Formula | C22H19FN2O4 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-[(2E)-2-[[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylidene]hydrazinyl]benzoic acid |
| SMILES | COc1ccc(/C=N/Nc2ccccc2C(=O)O)cc1COc1ccc(F)cc1 |
| InChI | InChI=1S/C22H19FN2O4/c1-28-21-11-6-15(12-16(21)14-29-18-9-7-17(23)8-10-18)13-24-25-20-5-3-2-4-19(20)22(26)27/h2-13,25H,14H2,1H3,(H,26,27)/b24-13+ |
| InChIKey | CNZWUSBWCYBVPU-ZMOGYAJESA-N |
| XLogP | 4.56 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|