C21H18F2N2O2 — CID 5348595
N-[(E)-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]aniline (PubChem CID 5348595) has the molecular formula C21H18F2N2O2 and a molecular weight of 368.38 g/mol. Its IUPAC name is N-[(E)-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]aniline.
| Compound Name | N-[(E)-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 5348595 |
| Molecular Formula | C21H18F2N2O2 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[(E)-[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]aniline |
| SMILES | COc1ccc(/C=N/Nc2ccccc2)cc1COc1ccc(F)cc1F |
| InChI | InChI=1S/C21H18F2N2O2/c1-26-20-9-7-15(13-24-25-18-5-3-2-4-6-18)11-16(20)14-27-21-10-8-17(22)12-19(21)23/h2-13,25H,14H2,1H3/b24-13+ |
| InChIKey | VSVDJUSPUSGDJO-ZMOGYAJESA-N |
| XLogP | 5.00 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|