C19H19F2N3O2S — CID 3674989
1-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3-prop-2-enylthiourea (PubChem CID 3674989) has the molecular formula C19H19F2N3O2S and a molecular weight of 391.44 g/mol. Its IUPAC name is 1-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3674989 |
| Molecular Formula | C19H19F2N3O2S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NN=Cc1ccc(OC)c(COc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C19H19F2N3O2S/c1-3-8-22-19(27)24-23-11-13-4-6-17(25-2)14(9-13)12-26-18-7-5-15(20)10-16(18)21/h3-7,9-11H,1,8,12H2,2H3,(H2,22,24,27) |
| InChIKey | OESQWCOHYBLNNR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|