C25H28N2O2 — CID 169382404
N-[[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]aniline (PubChem CID 169382404) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]aniline.
| Compound Name | N-[[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 169382404 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-[[3-[(4-tert-butylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]aniline |
| SMILES | COc1ccc(C=NNc2ccccc2)cc1COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H28N2O2/c1-25(2,3)21-11-13-23(14-12-21)29-18-20-16-19(10-15-24(20)28-4)17-26-27-22-8-6-5-7-9-22/h5-17,27H,18H2,1-4H3 |
| InChIKey | IROCCDADZXEOLF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|