C23H21N2O5- — CID 7741451
4-[(2Z)-2-[[4-methoxy-3-[(3-methoxyphenoxy)methyl]phenyl]methylidene]hydrazinyl]benzoate (PubChem CID 7741451) has the molecular formula C23H21N2O5- and a molecular weight of 405.43 g/mol. Its IUPAC name is 4-[(2Z)-2-[[4-methoxy-3-[(3-methoxyphenoxy)methyl]phenyl]methylidene]hydrazinyl]benzoate.
| Compound Name | 4-[(2Z)-2-[[4-methoxy-3-[(3-methoxyphenoxy)methyl]phenyl]methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7741451 |
| Molecular Formula | C23H21N2O5- |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-[(2Z)-2-[[4-methoxy-3-[(3-methoxyphenoxy)methyl]phenyl]methylidene]hydrazinyl]benzoate |
| SMILES | COc1cccc(OCc2cc(/C=N\Nc3ccc(C(=O)[O-])cc3)ccc2OC)c1 |
| InChI | InChI=1S/C23H22N2O5/c1-28-20-4-3-5-21(13-20)30-15-18-12-16(6-11-22(18)29-2)14-24-25-19-9-7-17(8-10-19)23(26)27/h3-14,25H,15H2,1-2H3,(H,26,27)/p-1/b24-14- |
| InChIKey | XAVIKIBYDAOWPO-OYKKKHCWSA-M |
| XLogP | 3.09 |
| TPSA | 92.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|