C15H13N2O3- — CID 7824518
4-[2-[(4-methoxyphenyl)methylidene]hydrazinyl]benzoate (PubChem CID 7824518) has the molecular formula C15H13N2O3- and a molecular weight of 269.28 g/mol. Its IUPAC name is 4-[2-[(4-methoxyphenyl)methylidene]hydrazinyl]benzoate.
| Compound Name | 4-[2-[(4-methoxyphenyl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7824518 |
| Molecular Formula | C15H13N2O3- |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-[2-[(4-methoxyphenyl)methylidene]hydrazinyl]benzoate |
| SMILES | COc1ccc(C=NNc2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C15H14N2O3/c1-20-14-8-2-11(3-9-14)10-16-17-13-6-4-12(5-7-13)15(18)19/h2-10,17H,1H3,(H,18,19)/p-1 |
| InChIKey | XASZGQGECHWCOV-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|