C23H17F5N2O4 — CID 24818622
2-methoxy-N-[[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]methylideneamino]benzamide (PubChem CID 24818622) has the molecular formula C23H17F5N2O4 and a molecular weight of 480.39 g/mol. Its IUPAC name is 2-methoxy-N-[[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]methylideneamino]benzamide.
| Compound Name | 2-methoxy-N-[[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 24818622 |
| Molecular Formula | C23H17F5N2O4 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-methoxy-N-[[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccc(C=NNC(=O)c2ccccc2OC)cc1COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H17F5N2O4/c1-32-15-8-7-12(10-29-30-23(31)14-5-3-4-6-16(14)33-2)9-13(15)11-34-22-20(27)18(25)17(24)19(26)21(22)28/h3-10H,11H2,1-2H3,(H,30,31) |
| InChIKey | SISYZDHIYNAYIQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|