C24H23ClN2O4 — CID 6160205
N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-2-hydroxybenzamide (PubChem CID 6160205) has the molecular formula C24H23ClN2O4 and a molecular weight of 438.91 g/mol. Its IUPAC name is N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 6160205 |
| Molecular Formula | C24H23ClN2O4 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-[(Z)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-2-hydroxybenzamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2ccccc2O)cc1COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C24H23ClN2O4/c1-15-10-19(11-16(2)23(15)25)31-14-18-12-17(8-9-22(18)30-3)13-26-27-24(29)20-6-4-5-7-21(20)28/h4-13,28H,14H2,1-3H3,(H,27,29)/b26-13- |
| InChIKey | FMKXGZMXCAKDCY-ZMFRSBBQSA-N |
| XLogP | 5.01 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|