C25H23ClFN3O4 — CID 19660440
N'-[(E)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-N-(4-fluorophenyl)oxamide (PubChem CID 19660440) has the molecular formula C25H23ClFN3O4 and a molecular weight of 483.93 g/mol. Its IUPAC name is N'-[(E)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-N-(4-fluorophenyl)oxamide.
| Compound Name | N'-[(E)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-N-(4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 19660440 |
| Molecular Formula | C25H23ClFN3O4 |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | N'-[(E)-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-N-(4-fluorophenyl)oxamide |
| SMILES | COc1ccc(/C=N/NC(=O)C(=O)Nc2ccc(F)cc2)cc1COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C25H23ClFN3O4/c1-15-10-21(11-16(2)23(15)26)34-14-18-12-17(4-9-22(18)33-3)13-28-30-25(32)24(31)29-20-7-5-19(27)6-8-20/h4-13H,14H2,1-3H3,(H,29,31)(H,30,32)/b28-13+ |
| InChIKey | DVFJUDOMDVPXLO-XODNFHPESA-N |
| XLogP | 4.77 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|